1. Home/
  2. Compounds/
  3. AZD6244

AZD6244

Synonyms

SourcesNames Used
CCLE, GRAY, UHNBreastAZD6244
GDSC1000, CTRPv2selumetinib
FIMMSelumetinib
PharmacoGx AZD6244

External IDs

DatabaseIdentifier
Smiles: CN1C=NC2=C1C=C(C(=C2F)NC3=C(C=C(C=C3)Br)Cl)C(=O)NOCCO
Inchikey: CYOHGALHFOKKQC-UHFFFAOYSA-N
Pubchem: 10127622
Download Data as CSV

Top molecular features associated with response to AZD6244


Feature TypeStandardized
Nominal ANOVA
mRNA SPRY2 CCLE AAC 0.42 2e-18
mRNA LYZ CCLE AAC 0.38 8e-17
mRNA SPRY2 CTRPv2 AAC 0.29 3e-14
mRNA ZFP36L2 CTRPv2 AAC 0.27 6e-13
mRNA FERMT1 CTRPv2 AAC 0.29 2e-12
mRNA RNASE2 CCLE AAC 0.3 4e-12
mRNA FCER1G CCLE AAC 0.31 5e-12
mRNA ACY1 CTRPv2 AAC 0.26 9e-12
mRNA IRF2BP2 CTRPv2 AAC 0.25 1e-11
mRNA SLC35D2 CCLE AAC 0.4 4e-11
Download CSV